C19H20FNO — CID 82137279
2-(2-fluorophenyl)-4-(2,4,5-trimethylphenoxy)butanenitrile (PubChem CID 82137279) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-4-(2,4,5-trimethylphenoxy)butanenitrile.
| Compound Name | 2-(2-fluorophenyl)-4-(2,4,5-trimethylphenoxy)butanenitrile |
|---|---|
| PubChem CID | 82137279 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-(2-fluorophenyl)-4-(2,4,5-trimethylphenoxy)butanenitrile |
| SMILES | Cc1cc(C)c(OCCC(C#N)c2ccccc2F)cc1C |
| InChI | InChI=1S/C19H20FNO/c1-13-10-15(3)19(11-14(13)2)22-9-8-16(12-21)17-6-4-5-7-18(17)20/h4-7,10-11,16H,8-9H2,1-3H3 |
| InChIKey | AQPAYCCPIPTMDD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |