C19H21NO2 — CID 82137685
4-(2,6-dimethylphenoxy)-2-(2-methoxyphenyl)butanenitrile (PubChem CID 82137685) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-(2,6-dimethylphenoxy)-2-(2-methoxyphenyl)butanenitrile.
| Compound Name | 4-(2,6-dimethylphenoxy)-2-(2-methoxyphenyl)butanenitrile |
|---|---|
| PubChem CID | 82137685 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-(2,6-dimethylphenoxy)-2-(2-methoxyphenyl)butanenitrile |
| SMILES | COc1ccccc1C(C#N)CCOc1c(C)cccc1C |
| InChI | InChI=1S/C19H21NO2/c1-14-7-6-8-15(2)19(14)22-12-11-16(13-20)17-9-4-5-10-18(17)21-3/h4-10,16H,11-12H2,1-3H3 |
| InChIKey | ORXWKLSIDOKKQV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |