C17H15F2NO — CID 82137344
4-(3,4-difluorophenoxy)-2-(2-methylphenyl)butanenitrile (PubChem CID 82137344) has the molecular formula C17H15F2NO and a molecular weight of 287.31 g/mol. Its IUPAC name is 4-(3,4-difluorophenoxy)-2-(2-methylphenyl)butanenitrile.
| Compound Name | 4-(3,4-difluorophenoxy)-2-(2-methylphenyl)butanenitrile |
|---|---|
| PubChem CID | 82137344 |
| Molecular Formula | C17H15F2NO |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 4-(3,4-difluorophenoxy)-2-(2-methylphenyl)butanenitrile |
| SMILES | Cc1ccccc1C(C#N)CCOc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H15F2NO/c1-12-4-2-3-5-15(12)13(11-20)8-9-21-14-6-7-16(18)17(19)10-14/h2-7,10,13H,8-9H2,1H3 |
| InChIKey | URKOJHRIDRCYDH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |