C12H14F2N2O — CID 55144879
4-(3,4-difluorophenoxy)-2-(ethylamino)butanenitrile (PubChem CID 55144879) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is 4-(3,4-difluorophenoxy)-2-(ethylamino)butanenitrile.
| Compound Name | 4-(3,4-difluorophenoxy)-2-(ethylamino)butanenitrile |
|---|---|
| PubChem CID | 55144879 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4-(3,4-difluorophenoxy)-2-(ethylamino)butanenitrile |
| SMILES | CCNC(C#N)CCOc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H14F2N2O/c1-2-16-9(8-15)5-6-17-10-3-4-11(13)12(14)7-10/h3-4,7,9,16H,2,5-6H2,1H3 |
| InChIKey | QORMNLKSYILFCW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |