C13H17F2NO3 — CID 63035662
ethyl 4-(3,4-difluorophenoxy)-2-(methylamino)butanoate (PubChem CID 63035662) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is ethyl 4-(3,4-difluorophenoxy)-2-(methylamino)butanoate.
| Compound Name | ethyl 4-(3,4-difluorophenoxy)-2-(methylamino)butanoate |
|---|---|
| PubChem CID | 63035662 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | ethyl 4-(3,4-difluorophenoxy)-2-(methylamino)butanoate |
| SMILES | CCOC(=O)C(CCOc1ccc(F)c(F)c1)NC |
| InChI | InChI=1S/C13H17F2NO3/c1-3-18-13(17)12(16-2)6-7-19-9-4-5-10(14)11(15)8-9/h4-5,8,12,16H,3,6-7H2,1-2H3 |
| InChIKey | DIXWPVDHACJIDW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |