C16H24FNO3 — CID 107170470
ethyl 4-(3-fluoro-4-methylphenoxy)-2-(propan-2-ylamino)butanoate (PubChem CID 107170470) has the molecular formula C16H24FNO3 and a molecular weight of 297.37 g/mol. Its IUPAC name is ethyl 4-(3-fluoro-4-methylphenoxy)-2-(propan-2-ylamino)butanoate.
| Compound Name | ethyl 4-(3-fluoro-4-methylphenoxy)-2-(propan-2-ylamino)butanoate |
|---|---|
| PubChem CID | 107170470 |
| Molecular Formula | C16H24FNO3 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | ethyl 4-(3-fluoro-4-methylphenoxy)-2-(propan-2-ylamino)butanoate |
| SMILES | CCOC(=O)C(CCOc1ccc(C)c(F)c1)NC(C)C |
| InChI | InChI=1S/C16H24FNO3/c1-5-20-16(19)15(18-11(2)3)8-9-21-13-7-6-12(4)14(17)10-13/h6-7,10-11,15,18H,5,8-9H2,1-4H3 |
| InChIKey | UMHRYUUEAUKYKC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |