C16H25NO3S — CID 63034141
ethyl 4-(4-methoxyphenyl)sulfanyl-2-(propan-2-ylamino)butanoate (PubChem CID 63034141) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is ethyl 4-(4-methoxyphenyl)sulfanyl-2-(propan-2-ylamino)butanoate.
| Compound Name | ethyl 4-(4-methoxyphenyl)sulfanyl-2-(propan-2-ylamino)butanoate |
|---|---|
| PubChem CID | 63034141 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | ethyl 4-(4-methoxyphenyl)sulfanyl-2-(propan-2-ylamino)butanoate |
| SMILES | CCOC(=O)C(CCSc1ccc(OC)cc1)NC(C)C |
| InChI | InChI=1S/C16H25NO3S/c1-5-20-16(18)15(17-12(2)3)10-11-21-14-8-6-13(19-4)7-9-14/h6-9,12,15,17H,5,10-11H2,1-4H3 |
| InChIKey | XDQJTUHTHALTFY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |