C12H16O5S — CID 79671982
5-(2,3-dihydroxypropylsulfanylmethyl)-2-methoxybenzoic acid (PubChem CID 79671982) has the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropylsulfanylmethyl)-2-methoxybenzoic acid.
| Compound Name | 5-(2,3-dihydroxypropylsulfanylmethyl)-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 79671982 |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 5-(2,3-dihydroxypropylsulfanylmethyl)-2-methoxybenzoic acid |
| SMILES | COc1ccc(CSCC(O)CO)cc1C(=O)O |
| InChI | InChI=1S/C12H16O5S/c1-17-11-3-2-8(4-10(11)12(15)16)6-18-7-9(14)5-13/h2-4,9,13-14H,5-7H2,1H3,(H,15,16) |
| InChIKey | DOXDHRZXGUNICK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |