C12H18O2S — CID 71924619
3-[(2,6-dimethylphenyl)methylsulfanyl]propane-1,2-diol (PubChem CID 71924619) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 3-[(2,6-dimethylphenyl)methylsulfanyl]propane-1,2-diol.
| Compound Name | 3-[(2,6-dimethylphenyl)methylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 71924619 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-[(2,6-dimethylphenyl)methylsulfanyl]propane-1,2-diol |
| SMILES | Cc1cccc(C)c1CSCC(O)CO |
| InChI | InChI=1S/C12H18O2S/c1-9-4-3-5-10(2)12(9)8-15-7-11(14)6-13/h3-5,11,13-14H,6-8H2,1-2H3 |
| InChIKey | WHRMCQWXQLEJQS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |