C11H18N4O4 — CID 136816582
N'-hydroxy-3-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboximidamide (PubChem CID 136816582) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is N'-hydroxy-3-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboximidamide.
| Compound Name | N'-hydroxy-3-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 136816582 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | N'-hydroxy-3-[3-(2-methoxyethoxy)propoxy]pyrazine-2-carboximidamide |
| SMILES | COCCOCCCOc1nccnc1C(N)=NO |
| InChI | InChI=1S/C11H18N4O4/c1-17-7-8-18-5-2-6-19-11-9(10(12)15-16)13-3-4-14-11/h3-4,16H,2,5-8H2,1H3,(H2,12,15) |
| InChIKey | NZHPXPDONAMXRO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|