C12H18N2O3S — CID 103177659
2-[2-(3-methoxypropoxy)ethoxy]pyridine-3-carbothioamide (PubChem CID 103177659) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-[2-(3-methoxypropoxy)ethoxy]pyridine-3-carbothioamide.
| Compound Name | 2-[2-(3-methoxypropoxy)ethoxy]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 103177659 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[2-(3-methoxypropoxy)ethoxy]pyridine-3-carbothioamide |
| SMILES | COCCCOCCOc1ncccc1C(N)=S |
| InChI | InChI=1S/C12H18N2O3S/c1-15-6-3-7-16-8-9-17-12-10(11(13)18)4-2-5-14-12/h2,4-5H,3,6-9H2,1H3,(H2,13,18) |
| InChIKey | XCKXVWBUEIHBKY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|