C13H18BrNO3S — CID 103177666
4-bromo-2-[2-(3-methoxypropoxy)ethoxy]benzenecarbothioamide (PubChem CID 103177666) has the molecular formula C13H18BrNO3S and a molecular weight of 348.26 g/mol. Its IUPAC name is 4-bromo-2-[2-(3-methoxypropoxy)ethoxy]benzenecarbothioamide.
| Compound Name | 4-bromo-2-[2-(3-methoxypropoxy)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 103177666 |
| Molecular Formula | C13H18BrNO3S |
| Molecular Weight | 348.26 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 4-bromo-2-[2-(3-methoxypropoxy)ethoxy]benzenecarbothioamide |
| SMILES | COCCCOCCOc1cc(Br)ccc1C(N)=S |
| InChI | InChI=1S/C13H18BrNO3S/c1-16-5-2-6-17-7-8-18-12-9-10(14)3-4-11(12)13(15)19/h3-4,9H,2,5-8H2,1H3,(H2,15,19) |
| InChIKey | JOUDXWIHFKBRAK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|