C11H14BrNO2S — CID 114903718
4-bromo-2-(3-methoxypropoxy)benzenecarbothioamide (PubChem CID 114903718) has the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. Its IUPAC name is 4-bromo-2-(3-methoxypropoxy)benzenecarbothioamide.
| Compound Name | 4-bromo-2-(3-methoxypropoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 114903718 |
| Molecular Formula | C11H14BrNO2S |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 4-bromo-2-(3-methoxypropoxy)benzenecarbothioamide |
| SMILES | COCCCOc1cc(Br)ccc1C(N)=S |
| InChI | InChI=1S/C11H14BrNO2S/c1-14-5-2-6-15-10-7-8(12)3-4-9(10)11(13)16/h3-4,7H,2,5-6H2,1H3,(H2,13,16) |
| InChIKey | OEGRNZGTFURXLN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|