C13H14F3N5O2 — CID 84588425
N,6-dimethyl-5-nitro-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyridin-2-amine (PubChem CID 84588425) has the molecular formula C13H14F3N5O2 and a molecular weight of 329.28 g/mol. Its IUPAC name is N,6-dimethyl-5-nitro-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyridin-2-amine.
| Compound Name | N,6-dimethyl-5-nitro-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 84588425 |
| Molecular Formula | C13H14F3N5O2 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N,6-dimethyl-5-nitro-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyridin-2-amine |
| SMILES | Cc1nc(N(C)Cc2nccn2CC(F)(F)F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14F3N5O2/c1-9-10(21(22)23)3-4-11(18-9)19(2)7-12-17-5-6-20(12)8-13(14,15)16/h3-6H,7-8H2,1-2H3 |
| InChIKey | KWJPCCSRNXMZFQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|