C13H23N5O3 — CID 118861324
2-N-[2-(dimethylamino)ethyl]-2-N-methyl-3-nitro-6-propan-2-yloxypyridine-2,5-diamine (PubChem CID 118861324) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-N-[2-(dimethylamino)ethyl]-2-N-methyl-3-nitro-6-propan-2-yloxypyridine-2,5-diamine.
| Compound Name | 2-N-[2-(dimethylamino)ethyl]-2-N-methyl-3-nitro-6-propan-2-yloxypyridine-2,5-diamine |
|---|---|
| PubChem CID | 118861324 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2-N-[2-(dimethylamino)ethyl]-2-N-methyl-3-nitro-6-propan-2-yloxypyridine-2,5-diamine |
| SMILES | CC(C)Oc1nc(N(C)CCN(C)C)c([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C13H23N5O3/c1-9(2)21-13-10(14)8-11(18(19)20)12(15-13)17(5)7-6-16(3)4/h8-9H,6-7,14H2,1-5H3 |
| InChIKey | HYXNZAYHQJAPIT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 97.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|