C13H25N5O2 — CID 174193609
N-[5-amino-2-[2-(dimethylamino)ethyl-methylamino]-6-propan-2-yloxy-3-pyridinyl]hydroxylamine (PubChem CID 174193609) has the molecular formula C13H25N5O2 and a molecular weight of 283.38 g/mol. Its IUPAC name is N-[5-amino-2-[2-(dimethylamino)ethyl-methylamino]-6-propan-2-yloxy-3-pyridinyl]hydroxylamine.
| Compound Name | N-[5-amino-2-[2-(dimethylamino)ethyl-methylamino]-6-propan-2-yloxy-3-pyridinyl]hydroxylamine |
|---|---|
| PubChem CID | 174193609 |
| Molecular Formula | C13H25N5O2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | N-[5-amino-2-[2-(dimethylamino)ethyl-methylamino]-6-propan-2-yloxy-3-pyridinyl]hydroxylamine |
| SMILES | CC(C)Oc1nc(N(C)CCN(C)C)c(NO)cc1N |
| InChI | InChI=1S/C13H25N5O2/c1-9(2)20-13-10(14)8-11(16-19)12(15-13)18(5)7-6-17(3)4/h8-9,16,19H,6-7,14H2,1-5H3 |
| InChIKey | FPRXMYLEYANMBB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|