C27H25F6N5O6 — CID 169221883
[(6R,8Z)-12,12-dimethyl-17-nitro-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaen-10-yl] acetate (PubChem CID 169221883) has the molecular formula C27H25F6N5O6 and a molecular weight of 629.51 g/mol. Its IUPAC name is [(6R,8Z)-12,12-dimethyl-17-nitro-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaen-10-yl] acetate.
| Compound Name | [(6R,8Z)-12,12-dimethyl-17-nitro-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaen-10-yl] acetate |
|---|---|
| PubChem CID | 169221883 |
| Molecular Formula | C27H25F6N5O6 |
| Molecular Weight | 629.51 g/mol |
| Exact Mass | 629.17 |
| IUPAC Name | [(6R,8Z)-12,12-dimethyl-17-nitro-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,13,18-tetrazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,8,14(18),15-hexaen-10-yl] acetate |
| SMILES | CC(=O)OC1/C=C\C[C@](OCc2ccccc2)(C(F)(F)F)c2nnc(o2)-c2nc(c(C(F)(F)F)cc2[N+](=O)[O-])NC(C)(C)C1 |
| InChI | InChI=1S/C27H25F6N5O6/c1-15(39)43-17-10-7-11-25(27(31,32)33,42-14-16-8-5-4-6-9-16)23-37-36-22(44-23)20-19(38(40)41)12-18(26(28,29)30)21(34-20)35-24(2,3)13-17/h4-10,12,17H,11,13-14H2,1-3H3,(H,34,35)/b10-7-/t17?,25-/m1/s1 |
| InChIKey | ACORHSXDBWJMOT-NUVXCBIISA-N |
| XLogP | 6.51 |
| TPSA | 142.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.51 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|