C25H23BrF3N5O4 — CID 175741235
(12S)-18-bromo-20-nitro-6-phenylmethoxy-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(21),2,4,9,17,19-hexaene (PubChem CID 175741235) has the molecular formula C25H23BrF3N5O4 and a molecular weight of 594.39 g/mol. Its IUPAC name is (12S)-18-bromo-20-nitro-6-phenylmethoxy-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(21),2,4,9,17,19-hexaene.
| Compound Name | (12S)-18-bromo-20-nitro-6-phenylmethoxy-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(21),2,4,9,17,19-hexaene |
|---|---|
| PubChem CID | 175741235 |
| Molecular Formula | C25H23BrF3N5O4 |
| Molecular Weight | 594.39 g/mol |
| Exact Mass | 593.09 |
| IUPAC Name | (12S)-18-bromo-20-nitro-6-phenylmethoxy-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(21),2,4,9,17,19-hexaene |
| SMILES | O=[N+]([O-])c1cc(Br)c2nc1-c1nnc(o1)C(OCc1ccccc1)(C(F)(F)F)CCC=CC[C@@H]1CCCN21 |
| InChI | InChI=1S/C25H23BrF3N5O4/c26-18-14-19(34(35)36)20-22-31-32-23(38-22)24(25(27,28)29,37-15-16-8-3-1-4-9-16)12-6-2-5-10-17-11-7-13-33(17)21(18)30-20/h1-5,8-9,14,17H,6-7,10-13,15H2/t17-,24?/m1/s1 |
| InChIKey | ITPGIEXATXHQMT-BPNWFJGMSA-N |
| XLogP | 6.49 |
| TPSA | 107.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.39 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|