C26H23F3N6O4 — CID 163376776
(9Z,12S)-20-nitro-6-phenylmethoxy-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,9,17(21),18-hexaene-18-carbonitrile (PubChem CID 163376776) has the molecular formula C26H23F3N6O4 and a molecular weight of 540.50 g/mol. Its IUPAC name is (9Z,12S)-20-nitro-6-phenylmethoxy-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,9,17(21),18-hexaene-18-carbonitrile.
| Compound Name | (9Z,12S)-20-nitro-6-phenylmethoxy-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,9,17(21),18-hexaene-18-carbonitrile |
|---|---|
| PubChem CID | 163376776 |
| Molecular Formula | C26H23F3N6O4 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | (9Z,12S)-20-nitro-6-phenylmethoxy-6-(trifluoromethyl)-22-oxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,9,17(21),18-hexaene-18-carbonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])c2nc1N1CCC[C@H]1C/C=C\CCC(OCc1ccccc1)(C(F)(F)F)c1nnc-2o1 |
| InChI | InChI=1S/C26H23F3N6O4/c27-26(28,29)25(38-16-17-8-3-1-4-9-17)12-6-2-5-10-19-11-7-13-34(19)22-18(15-30)14-20(35(36)37)21(31-22)23-32-33-24(25)39-23/h1-5,8-9,14,19H,6-7,10-13,16H2/b5-2-/t19-,25?/m1/s1 |
| InChIKey | SQHFHVLDTYGHCC-JMWCBJHXSA-N |
| XLogP | 5.59 |
| TPSA | 131.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|