C25H23F6N5O5 — CID 175883500
20-nitro-6-phenylmethoxy-6,18-bis(trifluoromethyl)-10,22-dioxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,17(21),18-pentaene (PubChem CID 175883500) has the molecular formula C25H23F6N5O5 and a molecular weight of 587.48 g/mol. Its IUPAC name is 20-nitro-6-phenylmethoxy-6,18-bis(trifluoromethyl)-10,22-dioxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,17(21),18-pentaene.
| Compound Name | 20-nitro-6-phenylmethoxy-6,18-bis(trifluoromethyl)-10,22-dioxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,17(21),18-pentaene |
|---|---|
| PubChem CID | 175883500 |
| Molecular Formula | C25H23F6N5O5 |
| Molecular Weight | 587.48 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | 20-nitro-6-phenylmethoxy-6,18-bis(trifluoromethyl)-10,22-dioxa-3,4,16,21-tetrazatetracyclo[15.3.1.12,5.012,16]docosa-1(20),2,4,17(21),18-pentaene |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c2nc1-c1nnc(o1)C(OCc1ccccc1)(C(F)(F)F)CCCOCC1CCCN21 |
| InChI | InChI=1S/C25H23F6N5O5/c26-24(27,28)17-12-18(36(37)38)19-21-33-34-22(41-21)23(25(29,30)31,40-13-15-6-2-1-3-7-15)9-5-11-39-14-16-8-4-10-35(16)20(17)32-19/h1-3,6-7,12,16H,4-5,8-11,13-14H2 |
| InChIKey | ROVQMLIBLAXPPX-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 116.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|