C26H23F6N3O5 — CID 162772852
methyl (6R,9Z,12R)-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(18),2,4,9,14,16-hexaene-17-carboxylate (PubChem CID 162772852) has the molecular formula C26H23F6N3O5 and a molecular weight of 571.47 g/mol. Its IUPAC name is methyl (6R,9Z,12R)-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(18),2,4,9,14,16-hexaene-17-carboxylate.
| Compound Name | methyl (6R,9Z,12R)-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(18),2,4,9,14,16-hexaene-17-carboxylate |
|---|---|
| PubChem CID | 162772852 |
| Molecular Formula | C26H23F6N3O5 |
| Molecular Weight | 571.47 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | methyl (6R,9Z,12R)-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-13,19-dioxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(18),2,4,9,14,16-hexaene-17-carboxylate |
| SMILES | COC(=O)c1cc(C(F)(F)F)c2nc1-c1nnc(o1)[C@@](OCc1ccccc1)(C(F)(F)F)CC/C=C\C[C@@H](C)O2 |
| InChI | InChI=1S/C26H23F6N3O5/c1-15-9-5-4-8-12-24(26(30,31)32,38-14-16-10-6-3-7-11-16)23-35-34-21(40-23)19-17(22(36)37-2)13-18(25(27,28)29)20(33-19)39-15/h3-7,10-11,13,15H,8-9,12,14H2,1-2H3/b5-4-/t15-,24-/m1/s1 |
| InChIKey | BEABTRBKXVTDFM-OAPZGJQLSA-N |
| XLogP | 6.42 |
| TPSA | 96.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.47 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|