C17H17F5N4O4 — CID 166967081
2-[6-[(2R)-butan-2-yl]oxy-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-5-(3,3-difluoropent-4-en-2-yl)-1,3,4-oxadiazole (PubChem CID 166967081) has the molecular formula C17H17F5N4O4 and a molecular weight of 436.34 g/mol. Its IUPAC name is 2-[6-[(2R)-butan-2-yl]oxy-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-5-(3,3-difluoropent-4-en-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[6-[(2R)-butan-2-yl]oxy-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-5-(3,3-difluoropent-4-en-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 166967081 |
| Molecular Formula | C17H17F5N4O4 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-[6-[(2R)-butan-2-yl]oxy-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-5-(3,3-difluoropent-4-en-2-yl)-1,3,4-oxadiazole |
| SMILES | C=CC(F)(F)C(C)c1nnc(-c2nc(O[C@H](C)CC)c(C(F)(F)F)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C17H17F5N4O4/c1-5-8(3)29-14-10(17(20,21)22)7-11(26(27)28)12(23-14)15-25-24-13(30-15)9(4)16(18,19)6-2/h6-9H,2,5H2,1,3-4H3/t8-,9?/m1/s1 |
| InChIKey | UEGJDURURWBFBT-VEDVMXKPSA-N |
| XLogP | 5.16 |
| TPSA | 104.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|