C8H2ClF3N4O3 — CID 175933339
2-[6-chloro-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-1,3,4-oxadiazole (PubChem CID 175933339) has the molecular formula C8H2ClF3N4O3 and a molecular weight of 294.58 g/mol. Its IUPAC name is 2-[6-chloro-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-1,3,4-oxadiazole.
| Compound Name | 2-[6-chloro-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 175933339 |
| Molecular Formula | C8H2ClF3N4O3 |
| Molecular Weight | 294.58 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 2-[6-chloro-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c(Cl)nc1-c1nnco1 |
| InChI | InChI=1S/C8H2ClF3N4O3/c9-6-3(8(10,11)12)1-4(16(17)18)5(14-6)7-15-13-2-19-7/h1-2H |
| InChIKey | VWPSHGUXGWQCLR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 94.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|