C26H29F6N5O4 — CID 169136605
2-[5-amino-3-(trifluoromethyl)-6-[5-[1,1,1-trifluoro-2-phenylmethoxy-6-(propan-2-ylamino)hexan-2-yl]-1,3,4-oxadiazol-2-yl]-2-pyridinyl]acetic acid (PubChem CID 169136605) has the molecular formula C26H29F6N5O4 and a molecular weight of 589.54 g/mol. Its IUPAC name is 2-[5-amino-3-(trifluoromethyl)-6-[5-[1,1,1-trifluoro-2-phenylmethoxy-6-(propan-2-ylamino)hexan-2-yl]-1,3,4-oxadiazol-2-yl]-2-pyridinyl]acetic acid.
| Compound Name | 2-[5-amino-3-(trifluoromethyl)-6-[5-[1,1,1-trifluoro-2-phenylmethoxy-6-(propan-2-ylamino)hexan-2-yl]-1,3,4-oxadiazol-2-yl]-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 169136605 |
| Molecular Formula | C26H29F6N5O4 |
| Molecular Weight | 589.54 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | 2-[5-amino-3-(trifluoromethyl)-6-[5-[1,1,1-trifluoro-2-phenylmethoxy-6-(propan-2-ylamino)hexan-2-yl]-1,3,4-oxadiazol-2-yl]-2-pyridinyl]acetic acid |
| SMILES | CC(C)NCCCCC(OCc1ccccc1)(c1nnc(-c2nc(CC(=O)O)c(C(F)(F)F)cc2N)o1)C(F)(F)F |
| InChI | InChI=1S/C26H29F6N5O4/c1-15(2)34-11-7-6-10-24(26(30,31)32,40-14-16-8-4-3-5-9-16)23-37-36-22(41-23)21-18(33)12-17(25(27,28)29)19(35-21)13-20(38)39/h3-5,8-9,12,15,34H,6-7,10-11,13-14,33H2,1-2H3,(H,38,39) |
| InChIKey | ILEZNCUJOCFEAR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|