C22H29F3N2O7 — CID 169136573
ethane;methyl 3-[methoxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-pent-4-enoyl-5-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 169136573) has the molecular formula C22H29F3N2O7 and a molecular weight of 490.48 g/mol. Its IUPAC name is ethane;methyl 3-[methoxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-pent-4-enoyl-5-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | ethane;methyl 3-[methoxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-pent-4-enoyl-5-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 169136573 |
| Molecular Formula | C22H29F3N2O7 |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | ethane;methyl 3-[methoxycarbonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-pent-4-enoyl-5-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | C=CCCC(=O)c1nc(C(=O)OC)c(N(C(=O)OC)C(=O)OC(C)(C)C)cc1C(F)(F)F.CC |
| InChI | InChI=1S/C20H23F3N2O7.C2H6/c1-7-8-9-13(26)14-11(20(21,22)23)10-12(15(24-14)16(27)30-5)25(17(28)31-6)18(29)32-19(2,3)4;1-2/h7,10H,1,8-9H2,2-6H3;1-2H3 |
| InChIKey | XBBKAYZYQUBOMB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 112.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|