C17H23BrN2O6 — CID 169102531
3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-(bromomethyl)pyridine-2-carboxylic acid (PubChem CID 169102531) has the molecular formula C17H23BrN2O6 and a molecular weight of 431.28 g/mol. Its IUPAC name is 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-(bromomethyl)pyridine-2-carboxylic acid.
| Compound Name | 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-(bromomethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 169102531 |
| Molecular Formula | C17H23BrN2O6 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-(bromomethyl)pyridine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1cc(CBr)cnc1C(=O)O |
| InChI | InChI=1S/C17H23BrN2O6/c1-16(2,3)25-14(23)20(15(24)26-17(4,5)6)11-7-10(8-18)9-19-12(11)13(21)22/h7,9H,8H2,1-6H3,(H,21,22) |
| InChIKey | VBOOYRHLMWZMOZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|