C20H28BrNO6 — CID 67717072
5-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-3-(bromomethyl)-2-methylbenzoic acid (PubChem CID 67717072) has the molecular formula C20H28BrNO6 and a molecular weight of 458.35 g/mol. Its IUPAC name is 5-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-3-(bromomethyl)-2-methylbenzoic acid.
| Compound Name | 5-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-3-(bromomethyl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 67717072 |
| Molecular Formula | C20H28BrNO6 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 5-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-3-(bromomethyl)-2-methylbenzoic acid |
| SMILES | Cc1c(CBr)cc(CN(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1C(=O)O |
| InChI | InChI=1S/C20H28BrNO6/c1-12-14(10-21)8-13(9-15(12)16(23)24)11-22(17(25)27-19(2,3)4)18(26)28-20(5,6)7/h8-9H,10-11H2,1-7H3,(H,23,24) |
| InChIKey | GAZMCUQGPUXMDN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|