C18H24FNO6 — CID 159386555
2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-4-fluorobenzoic acid (PubChem CID 159386555) has the molecular formula C18H24FNO6 and a molecular weight of 369.39 g/mol. Its IUPAC name is 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-4-fluorobenzoic acid.
| Compound Name | 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 159386555 |
| Molecular Formula | C18H24FNO6 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-[[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]-4-fluorobenzoic acid |
| SMILES | CC(C)(C)OC(=O)N(Cc1cc(F)ccc1C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24FNO6/c1-17(2,3)25-15(23)20(16(24)26-18(4,5)6)10-11-9-12(19)7-8-13(11)14(21)22/h7-9H,10H2,1-6H3,(H,21,22) |
| InChIKey | LLOLKHIFNIJPSP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |