C20H22N2O8S — CID 163236619
dimethyl 5-[[5,6-bis(methoxycarbonyl)-3-pyridinyl]sulfanyl]pyridine-2,3-dicarboxylate;ethane (PubChem CID 163236619) has the molecular formula C20H22N2O8S and a molecular weight of 450.47 g/mol. Its IUPAC name is dimethyl 5-[[5,6-bis(methoxycarbonyl)-3-pyridinyl]sulfanyl]pyridine-2,3-dicarboxylate;ethane.
| Compound Name | dimethyl 5-[[5,6-bis(methoxycarbonyl)-3-pyridinyl]sulfanyl]pyridine-2,3-dicarboxylate;ethane |
|---|---|
| PubChem CID | 163236619 |
| Molecular Formula | C20H22N2O8S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | dimethyl 5-[[5,6-bis(methoxycarbonyl)-3-pyridinyl]sulfanyl]pyridine-2,3-dicarboxylate;ethane |
| SMILES | CC.COC(=O)c1cc(Sc2cnc(C(=O)OC)c(C(=O)OC)c2)cnc1C(=O)OC |
| InChI | InChI=1S/C18H16N2O8S.C2H6/c1-25-15(21)11-5-9(7-19-13(11)17(23)27-3)29-10-6-12(16(22)26-2)14(20-8-10)18(24)28-4;1-2/h5-8H,1-4H3;1-2H3 |
| InChIKey | ZQFIYXZCHDHSMV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 130.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|