C9H7N3O3 — CID 135984745
methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate (PubChem CID 135984745) has the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. Its IUPAC name is methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate.
| Compound Name | methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 135984745 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate |
| SMILES | COC(=O)c1ncc2nccnc2c1O |
| InChI | InChI=1S/C9H7N3O3/c1-15-9(14)7-8(13)6-5(4-12-7)10-2-3-11-6/h2-4,13H,1H3 |
| InChIKey | LLPHRFAXNGSAGO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |