About methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate
methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate (PubChem CID 135984745) has the molecular formula C9H7N3O3
and a molecular weight of 205.17 g/mol. Its IUPAC name is methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate.
Molecular Properties
| Compound Name | methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate |
| PubChem CID | 135984745 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate |
| SMILES | COC(=O)c1ncc2nccnc2c1O |
| InChI | InChI=1S/C9H7N3O3/c1-15-9(14)7-8(13)6-5(4-12-7)10-2-3-11-6/h2-4,13H,1H3 |
| InChIKey | LLPHRFAXNGSAGO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate?
The IUPAC name of methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate (CID 135984745) is methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate.
What is the SMILES notation for methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate?
The canonical SMILES for methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate is COC(=O)c1ncc2nccnc2c1O.
What is the InChIKey of methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate?
The InChIKey is LLPHRFAXNGSAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O3/c1-15-9(14)7-8(13)6-5(4-12-7)10-2-3-11-6/h2-4,13H,1H3.
What are the key properties of methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate?
methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate has a molecular weight of 205.17 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-hydroxypyrido[3,4-b]pyrazine-7-carboxylate is sourced from PubChem (CID 135984745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).