About methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate
methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate (PubChem CID 58882903) has the molecular formula C16H13F3N2O3
and a molecular weight of 338.29 g/mol. Its IUPAC name is methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate |
| PubChem CID | 58882903 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(Cc2ccccc2)cc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H13F3N2O3/c1-24-14(22)13-12(21-15(23)16(17,18)19)8-11(9-20-13)7-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3,(H,21,23) |
| InChIKey | HOORFPOKSRKRHR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate?
The IUPAC name of methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate (CID 58882903) is methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate?
The canonical SMILES for methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate is COC(=O)c1ncc(Cc2ccccc2)cc1NC(=O)C(F)(F)F.
What is the InChIKey of methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate?
The InChIKey is HOORFPOKSRKRHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3N2O3/c1-24-14(22)13-12(21-15(23)16(17,18)19)8-11(9-20-13)7-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3,(H,21,23).
What are the key properties of methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate?
methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate has a molecular weight of 338.29 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-benzyl-3-[(2,2,2-trifluoroacetyl)amino]pyridine-2-carboxylate is sourced from PubChem (CID 58882903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).