C29H30FN5O5 — CID 142873151
methyl 3-[(4-fluorophenyl)methyl]-5-(hydrazinecarbonyl)-8-phenylmethoxy-1,6-naphthyridine-7-carboxylate;morpholine (PubChem CID 142873151) has the molecular formula C29H30FN5O5 and a molecular weight of 547.59 g/mol. Its IUPAC name is methyl 3-[(4-fluorophenyl)methyl]-5-(hydrazinecarbonyl)-8-phenylmethoxy-1,6-naphthyridine-7-carboxylate;morpholine.
| Compound Name | methyl 3-[(4-fluorophenyl)methyl]-5-(hydrazinecarbonyl)-8-phenylmethoxy-1,6-naphthyridine-7-carboxylate;morpholine |
|---|---|
| PubChem CID | 142873151 |
| Molecular Formula | C29H30FN5O5 |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | methyl 3-[(4-fluorophenyl)methyl]-5-(hydrazinecarbonyl)-8-phenylmethoxy-1,6-naphthyridine-7-carboxylate;morpholine |
| SMILES | C1COCCN1.COC(=O)c1nc(C(=O)NN)c2cc(Cc3ccc(F)cc3)cnc2c1OCc1ccccc1 |
| InChI | InChI=1S/C25H21FN4O4.C4H9NO/c1-33-25(32)22-23(34-14-16-5-3-2-4-6-16)20-19(21(29-22)24(31)30-27)12-17(13-28-20)11-15-7-9-18(26)10-8-15;1-3-6-4-2-5-1/h2-10,12-13H,11,14,27H2,1H3,(H,30,31);5H,1-4H2 |
| InChIKey | XAVLSIXVUHZDSK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|