About 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile
3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile (PubChem CID 11589868) has the molecular formula C24H20FN3O
and a molecular weight of 385.44 g/mol. Its IUPAC name is 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile.
Molecular Properties
| Compound Name | 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile |
| PubChem CID | 11589868 |
| Molecular Formula | C24H20FN3O |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile |
| SMILES | Cc1c(C)n(Cc2cccc(C#N)c2)c2c(OCc3ccc(F)cc3)ccnc12 |
| InChI | InChI=1S/C24H20FN3O/c1-16-17(2)28(14-20-5-3-4-19(12-20)13-26)24-22(10-11-27-23(16)24)29-15-18-6-8-21(25)9-7-18/h3-12H,14-15H2,1-2H3 |
| InChIKey | FBKXNHHQQYBHRI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile?
The IUPAC name of 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile (CID 11589868) is 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile.
What is the SMILES notation for 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile?
The canonical SMILES for 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile is Cc1c(C)n(Cc2cccc(C#N)c2)c2c(OCc3ccc(F)cc3)ccnc12.
What is the InChIKey of 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile?
The InChIKey is FBKXNHHQQYBHRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20FN3O/c1-16-17(2)28(14-20-5-3-4-19(12-20)13-26)24-22(10-11-27-23(16)24)29-15-18-6-8-21(25)9-7-18/h3-12H,14-15H2,1-2H3.
What are the key properties of 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile?
3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile has a molecular weight of 385.44 g/mol, XLogP of 5.29, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridin-1-yl]methyl]benzonitrile is sourced from PubChem (CID 11589868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).