About 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine
1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine (PubChem CID 68704804) has the molecular formula C26H28N2O
and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine |
| PubChem CID | 68704804 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2c(OCc3ccc(C(C)C)cc3)ccnc12 |
| InChI | InChI=1S/C26H28N2O/c1-18(2)23-12-10-22(11-13-23)17-29-24-14-15-27-25-19(3)20(4)28(26(24)25)16-21-8-6-5-7-9-21/h5-15,18H,16-17H2,1-4H3 |
| InChIKey | ZARXSUGBNIALKL-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine?
The IUPAC name of 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine (CID 68704804) is 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine?
The canonical SMILES for 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine is Cc1c(C)n(Cc2ccccc2)c2c(OCc3ccc(C(C)C)cc3)ccnc12.
What is the InChIKey of 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine?
The InChIKey is ZARXSUGBNIALKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N2O/c1-18(2)23-12-10-22(11-13-23)17-29-24-14-15-27-25-19(3)20(4)28(26(24)25)16-21-8-6-5-7-9-21/h5-15,18H,16-17H2,1-4H3.
What are the key properties of 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine?
1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine has a molecular weight of 384.52 g/mol, XLogP of 6.40, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,3-dimethyl-7-[(4-propan-2-ylphenyl)methoxy]pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 68704804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).