C15H11Br2FN2 — CID 141136090
3,5-dibromo-1-[(4-fluorophenyl)methyl]-2-methylpyrrolo[2,3-c]pyridine (PubChem CID 141136090) has the molecular formula C15H11Br2FN2 and a molecular weight of 398.07 g/mol. Its IUPAC name is 3,5-dibromo-1-[(4-fluorophenyl)methyl]-2-methylpyrrolo[2,3-c]pyridine.
| Compound Name | 3,5-dibromo-1-[(4-fluorophenyl)methyl]-2-methylpyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 141136090 |
| Molecular Formula | C15H11Br2FN2 |
| Molecular Weight | 398.07 g/mol |
| Exact Mass | 395.93 |
| IUPAC Name | 3,5-dibromo-1-[(4-fluorophenyl)methyl]-2-methylpyrrolo[2,3-c]pyridine |
| SMILES | Cc1c(Br)c2cc(Br)ncc2n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H11Br2FN2/c1-9-15(17)12-6-14(16)19-7-13(12)20(9)8-10-2-4-11(18)5-3-10/h2-7H,8H2,1H3 |
| InChIKey | OWZMWSZBXMLLEC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.07 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|