C21H17ClFN3 — CID 1487315
2-(2-chloro-3-pyridinyl)-1-[(3-fluorophenyl)methyl]-5,6-dimethylbenzimidazole (PubChem CID 1487315) has the molecular formula C21H17ClFN3 and a molecular weight of 365.84 g/mol. Its IUPAC name is 2-(2-chloro-3-pyridinyl)-1-[(3-fluorophenyl)methyl]-5,6-dimethylbenzimidazole.
| Compound Name | 2-(2-chloro-3-pyridinyl)-1-[(3-fluorophenyl)methyl]-5,6-dimethylbenzimidazole |
|---|---|
| PubChem CID | 1487315 |
| Molecular Formula | C21H17ClFN3 |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-(2-chloro-3-pyridinyl)-1-[(3-fluorophenyl)methyl]-5,6-dimethylbenzimidazole |
| SMILES | Cc1cc2nc(-c3cccnc3Cl)n(Cc3cccc(F)c3)c2cc1C |
| InChI | InChI=1S/C21H17ClFN3/c1-13-9-18-19(10-14(13)2)26(12-15-5-3-6-16(23)11-15)21(25-18)17-7-4-8-24-20(17)22/h3-11H,12H2,1-2H3 |
| InChIKey | RXPPGEPLDJCMIR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|