C36H26IrN- — CID 140587226
2-[3-[3-(3,5-diphenylphenyl)phenyl]benzene-6-id-1-yl]-3-methylpyridine;iridium (PubChem CID 140587226) has the molecular formula C36H26IrN- and a molecular weight of 664.83 g/mol. Its IUPAC name is 2-[3-[3-(3,5-diphenylphenyl)phenyl]benzene-6-id-1-yl]-3-methylpyridine;iridium.
| Compound Name | 2-[3-[3-(3,5-diphenylphenyl)phenyl]benzene-6-id-1-yl]-3-methylpyridine;iridium |
|---|---|
| PubChem CID | 140587226 |
| Molecular Formula | C36H26IrN- |
| Molecular Weight | 664.83 g/mol |
| Exact Mass | 665.17 |
| IUPAC Name | 2-[3-[3-(3,5-diphenylphenyl)phenyl]benzene-6-id-1-yl]-3-methylpyridine;iridium |
| SMILES | Cc1cccnc1-c1[c-]ccc(-c2cccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2)c1.[Ir] |
| InChI | InChI=1S/C36H26N.Ir/c1-26-11-10-20-37-36(26)32-19-9-17-30(22-32)29-16-8-18-31(21-29)35-24-33(27-12-4-2-5-13-27)23-34(25-35)28-14-6-3-7-15-28;/h2-18,20-25H,1H3;/q-1; |
| InChIKey | ZDDRZCAVSZXTMZ-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.83 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|