C25H20IrN3- — CID 172522401
1-(2,6-dimethyl-4-phenylphenyl)-2-[(3-isocyanobenzene-6-id-1-yl)methyl]imidazole;iridium (PubChem CID 172522401) has the molecular formula C25H20IrN3- and a molecular weight of 554.67 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-phenylphenyl)-2-[(3-isocyanobenzene-6-id-1-yl)methyl]imidazole;iridium.
| Compound Name | 1-(2,6-dimethyl-4-phenylphenyl)-2-[(3-isocyanobenzene-6-id-1-yl)methyl]imidazole;iridium |
|---|---|
| PubChem CID | 172522401 |
| Molecular Formula | C25H20IrN3- |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | 1-(2,6-dimethyl-4-phenylphenyl)-2-[(3-isocyanobenzene-6-id-1-yl)methyl]imidazole;iridium |
| SMILES | [C-]#[N+]c1cc[c-]c(Cc2nccn2-c2c(C)cc(-c3ccccc3)cc2C)c1.[Ir] |
| InChI | InChI=1S/C25H20N3.Ir/c1-18-14-22(21-9-5-4-6-10-21)15-19(2)25(18)28-13-12-27-24(28)17-20-8-7-11-23(16-20)26-3;/h4-7,9-16H,17H2,1-2H3;/q-1; |
| InChIKey | WBAAXUDXWCFIDX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|