C34H24IrN4-2 — CID 164827342
iridium;4-methyl-1-phenyl-2-phenylimidazo[4,5-c]quinoline;2-phenylpyridine (PubChem CID 164827342) has the molecular formula C34H24IrN4-2 and a molecular weight of 680.81 g/mol. Its IUPAC name is iridium;4-methyl-1-phenyl-2-phenylimidazo[4,5-c]quinoline;2-phenylpyridine.
| Compound Name | iridium;4-methyl-1-phenyl-2-phenylimidazo[4,5-c]quinoline;2-phenylpyridine |
|---|---|
| PubChem CID | 164827342 |
| Molecular Formula | C34H24IrN4-2 |
| Molecular Weight | 680.81 g/mol |
| Exact Mass | 681.16 |
| IUPAC Name | iridium;4-methyl-1-phenyl-2-phenylimidazo[4,5-c]quinoline;2-phenylpyridine |
| SMILES | Cc1nc2ccccc2c2c1nc(-c1[c-]cccc1)n2-c1ccccc1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C23H16N3.C11H8N.Ir/c1-16-21-22(19-14-8-9-15-20(19)24-16)26(18-12-6-3-7-13-18)23(25-21)17-10-4-2-5-11-17;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-10,12-15H,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | UNASOJPSHDOZOM-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.81 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|