C38H27FIrN4O-2 — CID 164824787
2-(1-fluoro-3H-dibenzofuran-3-id-4-yl)-4,6,7-trimethyl-1-phenylimidazo[4,5-c]pyridine;iridium;2-phenylpyridine (PubChem CID 164824787) has the molecular formula C38H27FIrN4O-2 and a molecular weight of 766.88 g/mol. Its IUPAC name is 2-(1-fluoro-3H-dibenzofuran-3-id-4-yl)-4,6,7-trimethyl-1-phenylimidazo[4,5-c]pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-(1-fluoro-3H-dibenzofuran-3-id-4-yl)-4,6,7-trimethyl-1-phenylimidazo[4,5-c]pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 164824787 |
| Molecular Formula | C38H27FIrN4O-2 |
| Molecular Weight | 766.88 g/mol |
| Exact Mass | 767.18 |
| IUPAC Name | 2-(1-fluoro-3H-dibenzofuran-3-id-4-yl)-4,6,7-trimethyl-1-phenylimidazo[4,5-c]pyridine;iridium;2-phenylpyridine |
| SMILES | Cc1nc(C)c2nc(-c3[c-]cc(F)c4c3oc3ccccc34)n(-c3ccccc3)c2c1C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C27H19FN3O.C11H8N.Ir/c1-15-16(2)29-17(3)24-25(15)31(18-9-5-4-6-10-18)27(30-24)20-13-14-21(28)23-19-11-7-8-12-22(19)32-26(20)23;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-12,14H,1-3H3;1-6,8-9H;/q2*-1; |
| InChIKey | KPRXFZUYKPZLIB-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.88 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|