C36H25IrN5O-2 — CID 164824741
iridium;2-methyl-8-(4-methyl-3-phenylimidazo[4,5-c]pyridin-2-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine (PubChem CID 164824741) has the molecular formula C36H25IrN5O-2 and a molecular weight of 735.85 g/mol. Its IUPAC name is iridium;2-methyl-8-(4-methyl-3-phenylimidazo[4,5-c]pyridin-2-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine.
| Compound Name | iridium;2-methyl-8-(4-methyl-3-phenylimidazo[4,5-c]pyridin-2-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine |
|---|---|
| PubChem CID | 164824741 |
| Molecular Formula | C36H25IrN5O-2 |
| Molecular Weight | 735.85 g/mol |
| Exact Mass | 736.17 |
| IUPAC Name | iridium;2-methyl-8-(4-methyl-3-phenylimidazo[4,5-c]pyridin-2-yl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;2-phenylpyridine |
| SMILES | Cc1ccc2c(n1)oc1c(-c3nc4ccnc(C)c4n3-c3ccccc3)[c-]ccc12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C25H17N4O.C11H8N.Ir/c1-15-11-12-19-18-9-6-10-20(23(18)30-25(19)27-15)24-28-21-13-14-26-16(2)22(21)29(24)17-7-4-3-5-8-17;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-9,11-14H,1-2H3;1-6,8-9H;/q2*-1; |
| InChIKey | IDZOCEKUXHCYBN-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.85 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|