C37H31GeIrN3-2 — CID 166018565
iridium;2-phenylpyridine;trimethyl-(5-phenyl-3-phenylpyrido[4,3-b]indol-6-yl)germane (PubChem CID 166018565) has the molecular formula C37H31GeIrN3-2 and a molecular weight of 782.50 g/mol. Its IUPAC name is iridium;2-phenylpyridine;trimethyl-(5-phenyl-3-phenylpyrido[4,3-b]indol-6-yl)germane.
| Compound Name | iridium;2-phenylpyridine;trimethyl-(5-phenyl-3-phenylpyrido[4,3-b]indol-6-yl)germane |
|---|---|
| PubChem CID | 166018565 |
| Molecular Formula | C37H31GeIrN3-2 |
| Molecular Weight | 782.50 g/mol |
| Exact Mass | 784.14 |
| IUPAC Name | iridium;2-phenylpyridine;trimethyl-(5-phenyl-3-phenylpyrido[4,3-b]indol-6-yl)germane |
| SMILES | C[Ge](C)(C)c1cccc2c3cnc(-c4[c-]cccc4)cc3n(-c3ccccc3)c12.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C26H23GeN2.C11H8N.Ir/c1-27(2,3)23-16-10-15-21-22-18-28-24(19-11-6-4-7-12-19)17-25(22)29(26(21)23)20-13-8-5-9-14-20;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h4-11,13-18H,1-3H3;1-6,8-9H;/q2*-1; |
| InChIKey | YGVGVSIJZGOVLM-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.50 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|