C44H35GeIrN3O-2 — CID 170531513
iridium;3-(1-methyl-3H-dibenzofuran-3-id-4-yl)-5-phenylpyrido[4,3-b]indole;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 170531513) has the molecular formula C44H35GeIrN3O-2 and a molecular weight of 886.61 g/mol. Its IUPAC name is iridium;3-(1-methyl-3H-dibenzofuran-3-id-4-yl)-5-phenylpyrido[4,3-b]indole;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | iridium;3-(1-methyl-3H-dibenzofuran-3-id-4-yl)-5-phenylpyrido[4,3-b]indole;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 170531513 |
| Molecular Formula | C44H35GeIrN3O-2 |
| Molecular Weight | 886.61 g/mol |
| Exact Mass | 888.16 |
| IUPAC Name | iridium;3-(1-methyl-3H-dibenzofuran-3-id-4-yl)-5-phenylpyrido[4,3-b]indole;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1c[c-]c(-c2cc3c(cn2)c2ccccc2n3-c2ccccc2)c2oc3ccccc3c12.[Ir] |
| InChI | InChI=1S/C30H19N2O.C14H16GeN.Ir/c1-19-15-16-22(30-29(19)23-12-6-8-14-28(23)33-30)25-17-27-24(18-31-25)21-11-5-7-13-26(21)32(27)20-9-3-2-4-10-20;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h2-15,17-18H,1H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | WKPCZBWEWFRRDG-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.61 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|