C51H38GeIrN4OS-2 — CID 156672203
8-(1-dibenzothiophen-3-ylbenzimidazol-2-yl)-5-methyl-2-phenyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 156672203) has the molecular formula C51H38GeIrN4OS-2 and a molecular weight of 1019.79 g/mol. Its IUPAC name is 8-(1-dibenzothiophen-3-ylbenzimidazol-2-yl)-5-methyl-2-phenyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | 8-(1-dibenzothiophen-3-ylbenzimidazol-2-yl)-5-methyl-2-phenyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 156672203 |
| Molecular Formula | C51H38GeIrN4OS-2 |
| Molecular Weight | 1019.79 g/mol |
| Exact Mass | 1021.16 |
| IUPAC Name | 8-(1-dibenzothiophen-3-ylbenzimidazol-2-yl)-5-methyl-2-phenyl-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1c[c-]c(-c2nc3ccccc3n2-c2ccc3c(c2)sc2ccccc23)c2oc3nc(-c4ccccc4)ccc3c12.[Ir] |
| InChI | InChI=1S/C37H22N3OS.C14H16GeN.Ir/c1-22-15-17-28(35-34(22)27-19-20-29(39-37(27)41-35)23-9-3-2-4-10-23)36-38-30-12-6-7-13-31(30)40(36)24-16-18-26-25-11-5-8-14-32(25)42-33(26)21-24;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h2-16,18-21H,1H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | UGEBFJIHZAMFMD-UHFFFAOYSA-N |
| XLogP | 13.22 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.79 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|