C26H23GeIrN2- — CID 166018611
iridium;trimethyl-(5-phenyl-1-phenylpyrido[4,3-b]indol-6-yl)germane (PubChem CID 166018611) has the molecular formula C26H23GeIrN2- and a molecular weight of 628.31 g/mol. Its IUPAC name is iridium;trimethyl-(5-phenyl-1-phenylpyrido[4,3-b]indol-6-yl)germane.
| Compound Name | iridium;trimethyl-(5-phenyl-1-phenylpyrido[4,3-b]indol-6-yl)germane |
|---|---|
| PubChem CID | 166018611 |
| Molecular Formula | C26H23GeIrN2- |
| Molecular Weight | 628.31 g/mol |
| Exact Mass | 630.07 |
| IUPAC Name | iridium;trimethyl-(5-phenyl-1-phenylpyrido[4,3-b]indol-6-yl)germane |
| SMILES | C[Ge](C)(C)c1cccc2c3c(-c4[c-]cccc4)nccc3n(-c3ccccc3)c12.[Ir] |
| InChI | InChI=1S/C26H23GeN2.Ir/c1-27(2,3)22-16-10-15-21-24-23(29(26(21)22)20-13-8-5-9-14-20)17-18-28-25(24)19-11-6-4-7-12-19;/h4-11,13-18H,1-3H3;/q-1; |
| InChIKey | DLWHYPXFJPJWBT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.31 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|