About iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine
iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine (PubChem CID 58987207) has the molecular formula C17H10IrNS-
and a molecular weight of 452.56 g/mol. Its IUPAC name is iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine |
| PubChem CID | 58987207 |
| Molecular Formula | C17H10IrNS- |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine |
| SMILES | [Ir].[c-]1ccccc1-c1nccc2sc3ccccc3c12 |
| InChI | InChI=1S/C17H10NS.Ir/c1-2-6-12(7-3-1)17-16-13-8-4-5-9-14(13)19-15(16)10-11-18-17;/h1-6,8-11H;/q-1; |
| InChIKey | ZNMIWNXDHIDNSJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine?
The IUPAC name of iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine (CID 58987207) is iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine.
What is the SMILES notation for iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine?
The canonical SMILES for iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine is [Ir].[c-]1ccccc1-c1nccc2sc3ccccc3c12.
What is the InChIKey of iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine?
The InChIKey is ZNMIWNXDHIDNSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10NS.Ir/c1-2-6-12(7-3-1)17-16-13-8-4-5-9-14(13)19-15(16)10-11-18-17;/h1-6,8-11H;/q-1;.
What are the key properties of iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine?
iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine has a molecular weight of 452.56 g/mol, XLogP of 4.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine is sourced from PubChem (CID 58987207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).