C17H10IrNS- — CID 58987207
iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine (PubChem CID 58987207) has the molecular formula C17H10IrNS- and a molecular weight of 452.56 g/mol. Its IUPAC name is iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine.
| Compound Name | iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 58987207 |
| Molecular Formula | C17H10IrNS- |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | iridium;1-phenyl-[1]benzothiolo[3,2-c]pyridine |
| SMILES | [Ir].[c-]1ccccc1-c1nccc2sc3ccccc3c12 |
| InChI | InChI=1S/C17H10NS.Ir/c1-2-6-12(7-3-1)17-16-13-8-4-5-9-14(13)19-15(16)10-11-18-17;/h1-6,8-11H;/q-1; |
| InChIKey | ZNMIWNXDHIDNSJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|