C30H22IrN4-2 — CID 164827189
iridium;5-methyl-1-phenyl-2-phenylimidazo[4,5-b]pyridine;2-phenylpyridine (PubChem CID 164827189) has the molecular formula C30H22IrN4-2 and a molecular weight of 630.75 g/mol. Its IUPAC name is iridium;5-methyl-1-phenyl-2-phenylimidazo[4,5-b]pyridine;2-phenylpyridine.
| Compound Name | iridium;5-methyl-1-phenyl-2-phenylimidazo[4,5-b]pyridine;2-phenylpyridine |
|---|---|
| PubChem CID | 164827189 |
| Molecular Formula | C30H22IrN4-2 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 631.15 |
| IUPAC Name | iridium;5-methyl-1-phenyl-2-phenylimidazo[4,5-b]pyridine;2-phenylpyridine |
| SMILES | Cc1ccc2c(n1)nc(-c1[c-]cccc1)n2-c1ccccc1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C19H14N3.C11H8N.Ir/c1-14-12-13-17-18(20-14)21-19(15-8-4-2-5-9-15)22(17)16-10-6-3-7-11-16;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-8,10-13H,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | VLJYNVHYSSGHCT-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|