About CID 176583832
CID 176583832 (PubChem CID 176583832) has the molecular formula C57H56IrN2O-2
and a molecular weight of 980.32 g/mol.
Molecular Properties
| Compound Name | CID 176583832 |
| PubChem CID | 176583832 |
| Molecular Formula | C57H56IrN2O-2 |
| Molecular Weight | 980.32 g/mol |
| Exact Mass | 980.42 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]cccc2)c1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccc(C(C)(C)C)cc54)cc23)cc1-c1c(C(C)C)cccc1C(C)C.[Ir] |
| InChI | InChI=1S/C42H40NO.C15H16N.Ir/c1-24(2)30-11-9-12-31(25(3)4)40(30)34-21-38(43-23-26(34)5)33-14-10-13-32-37-19-28-16-15-27-17-18-29(42(6,7)8)20-35(27)36(28)22-39(37)44-41(32)33;1-15(2,3)13-9-10-16-14(11-13)12-7-5-4-6-8-12;/h9-13,15-25H,1-8H3;4-7,9-11H,1-3H3;/q2*-1;/i5D3;; |
| InChIKey | FSVPDMADRVLODE-YLSPSJLGSA-N |
| XLogP | 16.12 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 980.32 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176583832 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176583832?
The IUPAC name of CID 176583832 (CID 176583832) is not available.
What is the SMILES notation for CID 176583832?
The canonical SMILES for CID 176583832 is CC(C)(C)c1ccnc(-c2[c-]cccc2)c1.[2H]C([2H])([2H])c1cnc(-c2[c-]ccc3c2oc2cc4c(ccc5ccc(C(C)(C)C)cc54)cc23)cc1-c1c(C(C)C)cccc1C(C)C.[Ir].
What is the InChIKey of CID 176583832?
The InChIKey is FSVPDMADRVLODE-YLSPSJLGSA-N. The full InChI is InChI=1S/C42H40NO.C15H16N.Ir/c1-24(2)30-11-9-12-31(25(3)4)40(30)34-21-38(43-23-26(34)5)33-14-10-13-32-37-19-28-16-15-27-17-18-29(42(6,7)8)20-35(27)36(28)22-39(37)44-41(32)33;1-15(2,3)13-9-10-16-14(11-13)12-7-5-4-6-8-12;/h9-13,15-25H,1-8H3;4-7,9-11H,1-3H3;/q2*-1;/i5D3;;.
What are the key properties of CID 176583832?
CID 176583832 has a molecular weight of 980.32 g/mol, XLogP of 16.12, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176583832 is sourced from PubChem (CID 176583832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).