C54H51IrN3O+ — CID 176756670
CID 176756670 (PubChem CID 176756670) has the molecular formula C54H51IrN3O+ and a molecular weight of 958.29 g/mol.
| Compound Name | CID 176756670 |
|---|---|
| PubChem CID | 176756670 |
| Molecular Formula | C54H51IrN3O+ |
| Molecular Weight | 958.29 g/mol |
| Exact Mass | 958.42 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[n+]1[c-]n(-c2[c-]cccc2)cc1.[2H]c1cc(C2([2H])CCC(C)(C)CC2)cc(C([2H])([2H])[2H])c1-c1cc(-c2[c-]ccc3c2oc2cc4c(ccc5ccccc54)cc23)ncc1C([2H])([2H])[2H].[Ir+3] |
| InChI | InChI=1S/C41H36NO.C13H15N2.Ir/c1-25-20-29(27-16-18-41(3,4)19-17-27)14-15-31(25)35-22-38(42-24-26(35)2)34-11-7-10-33-37-21-30-13-12-28-8-5-6-9-32(28)36(30)23-39(37)43-40(33)34;1-13(2,3)15-10-9-14(11-15)12-7-5-4-6-8-12;/h5-10,12-15,20-24,27H,16-19H2,1-4H3;4-7,9-10H,1-3H3;/q2*-1;+3/i1D3,2D3,15D,27D;; |
| InChIKey | GUUFEXZKFCCJDP-IOWGYYSISA-N |
| XLogP | 13.84 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.29 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|