C33H29NO — CID 157396309
4-(1-deuterio-4,4-dimethylcyclohexyl)-2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)pyridine (PubChem CID 157396309) has the molecular formula C33H29NO and a molecular weight of 456.61 g/mol. Its IUPAC name is 4-(1-deuterio-4,4-dimethylcyclohexyl)-2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)pyridine.
| Compound Name | 4-(1-deuterio-4,4-dimethylcyclohexyl)-2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)pyridine |
|---|---|
| PubChem CID | 157396309 |
| Molecular Formula | C33H29NO |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 4-(1-deuterio-4,4-dimethylcyclohexyl)-2-(10-oxapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1,3(11),4(9),5,7,12,14,16,18,20-decaen-8-yl)pyridine |
| SMILES | [2H]C1(c2ccnc(-c3cccc4c3oc3cc5c(ccc6ccccc65)cc34)c2)CCC(C)(C)CC1 |
| InChI | InChI=1S/C33H29NO/c1-33(2)15-12-21(13-16-33)23-14-17-34-30(19-23)27-9-5-8-26-29-18-24-11-10-22-6-3-4-7-25(22)28(24)20-31(29)35-32(26)27/h3-11,14,17-21H,12-13,15-16H2,1-2H3/i21D |
| InChIKey | GBKZMJRSRROYTK-KRLANHAZSA-N |
| XLogP | 9.64 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|